Carboxylic acids and derivatives
Filtered Search Results
Ethylenediaminetetraacetic acid tripotassium salt
CAS: 17572-97-3 Molecular Formula: C10H13K3N2O8 Molecular Weight (g/mol): 406.52 MDL Number: MFCD00013304 InChI Key: FYZXEMANQYHCFX-UHFFFAOYSA-K Synonym: edetate tripotassium,tripotassium edta,edta tripotassium salt,ethylenediaminetetraacetic acid tripotassium salt,tripotassium hydrogen ethylenediaminetetraacetate,sequestrene 50k3,unii-kia5203u1h,tripotassium ethylenediaminetetraacetate,edta-3k,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tripotassium salt PubChem CID: 62717 IUPAC Name: tripotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate SMILES: [K+].[K+].[K+].OC(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 62717 |
|---|---|
| CAS | 17572-97-3 |
| Molecular Weight (g/mol) | 406.52 |
| MDL Number | MFCD00013304 |
| SMILES | [K+].[K+].[K+].OC(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | edetate tripotassium,tripotassium edta,edta tripotassium salt,ethylenediaminetetraacetic acid tripotassium salt,tripotassium hydrogen ethylenediaminetetraacetate,sequestrene 50k3,unii-kia5203u1h,tripotassium ethylenediaminetetraacetate,edta-3k,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tripotassium salt |
| IUPAC Name | tripotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate |
| InChI Key | FYZXEMANQYHCFX-UHFFFAOYSA-K |
| Molecular Formula | C10H13K3N2O8 |
Trimethylolpropane triacrylate, stabilized
CAS: 15625-89-5 Molecular Formula: C15H20O6 Molecular Weight (g/mol): 296.32 MDL Number: MFCD00008628 InChI Key: DAKWPKUUDNSNPN-UHFFFAOYSA-N Synonym: trimethylolpropane triacrylate,tmpta,viscoat 295,nk ester a tmpt,sartomer sr 351,ogumont t 200,saret 351,setalux uv 2241,ccris 92,unii-4b67kgl96s PubChem CID: 27423 ChEBI: CHEBI:35028 IUPAC Name: 2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate SMILES: CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C
| PubChem CID | 27423 |
|---|---|
| CAS | 15625-89-5 |
| Molecular Weight (g/mol) | 296.32 |
| ChEBI | CHEBI:35028 |
| MDL Number | MFCD00008628 |
| SMILES | CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| Synonym | trimethylolpropane triacrylate,tmpta,viscoat 295,nk ester a tmpt,sartomer sr 351,ogumont t 200,saret 351,setalux uv 2241,ccris 92,unii-4b67kgl96s |
| IUPAC Name | 2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate |
| InChI Key | DAKWPKUUDNSNPN-UHFFFAOYSA-N |
| Molecular Formula | C15H20O6 |
Manganese(II) oxalate dihydrate, Mn 30% min
CAS: 6556-16-7 Molecular Formula: C2H4MnO6 Molecular Weight (g/mol): 178.986 MDL Number: MFCD00150452 InChI Key: HDJUVFZHZGPHCQ-UHFFFAOYSA-L Synonym: manganese ii oxalate 2-hydrate PubChem CID: 131882857 IUPAC Name: manganese(2+);oxalate;dihydrate SMILES: C(=O)(C(=O)[O-])[O-].O.O.[Mn+2]
| PubChem CID | 131882857 |
|---|---|
| CAS | 6556-16-7 |
| Molecular Weight (g/mol) | 178.986 |
| MDL Number | MFCD00150452 |
| SMILES | C(=O)(C(=O)[O-])[O-].O.O.[Mn+2] |
| Synonym | manganese ii oxalate 2-hydrate |
| IUPAC Name | manganese(2+);oxalate;dihydrate |
| InChI Key | HDJUVFZHZGPHCQ-UHFFFAOYSA-L |
| Molecular Formula | C2H4MnO6 |
Rubidium acetate, 99.8% (metals basis)
CAS: 563-67-7 Molecular Formula: C2H3O2Rb Molecular Weight (g/mol): 144.51 MDL Number: MFCD00013058 InChI Key: FOGKDYADEBOSPL-UHFFFAOYSA-M Synonym: rubidium acetate,acetic acid, rubidium salt,unii-86h795sz6d,acetic acid, rubidium salt 1:1,acetic acid rubidium,rubidio acetate,acmc-1aks3,rubidium 1+ acetate ion,rubidium 1+ ion acetate,c2h3o2.rb PubChem CID: 23673628 IUPAC Name: rubidium(1+);acetate SMILES: [Rb+].CC([O-])=O
| PubChem CID | 23673628 |
|---|---|
| CAS | 563-67-7 |
| Molecular Weight (g/mol) | 144.51 |
| MDL Number | MFCD00013058 |
| SMILES | [Rb+].CC([O-])=O |
| Synonym | rubidium acetate,acetic acid, rubidium salt,unii-86h795sz6d,acetic acid, rubidium salt 1:1,acetic acid rubidium,rubidio acetate,acmc-1aks3,rubidium 1+ acetate ion,rubidium 1+ ion acetate,c2h3o2.rb |
| IUPAC Name | rubidium(1+);acetate |
| InChI Key | FOGKDYADEBOSPL-UHFFFAOYSA-M |
| Molecular Formula | C2H3O2Rb |
Butyl stearate, tech.
CAS: 123-95-5 Molecular Formula: C22H44O2 Molecular Weight (g/mol): 340.59 MDL Number: MFCD00026669 InChI Key: ULBTUVJTXULMLP-UHFFFAOYSA-N Synonym: butyl stearate,n-butyl stearate,octadecanoic acid, butyl ester,kesscoflex bs,n-butyl octadecanoate,stearic acid, butyl ester,butyl octadecylate,kessco bsc,stearic acid n-butyl ester,polycizer 332 PubChem CID: 31278 ChEBI: CHEBI:85983 IUPAC Name: butyl octadecanoate SMILES: CCCCCCCCCCCCCCCCCC(=O)OCCCC
| PubChem CID | 31278 |
|---|---|
| CAS | 123-95-5 |
| Molecular Weight (g/mol) | 340.59 |
| ChEBI | CHEBI:85983 |
| MDL Number | MFCD00026669 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCCC |
| Synonym | butyl stearate,n-butyl stearate,octadecanoic acid, butyl ester,kesscoflex bs,n-butyl octadecanoate,stearic acid, butyl ester,butyl octadecylate,kessco bsc,stearic acid n-butyl ester,polycizer 332 |
| IUPAC Name | butyl octadecanoate |
| InChI Key | ULBTUVJTXULMLP-UHFFFAOYSA-N |
| Molecular Formula | C22H44O2 |
Benzanilide, 98+%
CAS: 93-98-1 Molecular Formula: C13H11NO Molecular Weight (g/mol): 197.237 MDL Number: MFCD00003069 InChI Key: ZVSKZLHKADLHSD-UHFFFAOYSA-N Synonym: benzanilide,n-benzoylaniline,benzamide, n-phenyl,n-phenyl-benzamide,benzoic acid anilide,unii-ak1b12366o,phenyl-n-benzamide,benzanilid,benzoylanilide,n-benzoyl aniline PubChem CID: 7168 IUPAC Name: N-phenylbenzamide SMILES: C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2
| PubChem CID | 7168 |
|---|---|
| CAS | 93-98-1 |
| Molecular Weight (g/mol) | 197.237 |
| MDL Number | MFCD00003069 |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2 |
| Synonym | benzanilide,n-benzoylaniline,benzamide, n-phenyl,n-phenyl-benzamide,benzoic acid anilide,unii-ak1b12366o,phenyl-n-benzamide,benzanilid,benzoylanilide,n-benzoyl aniline |
| IUPAC Name | N-phenylbenzamide |
| InChI Key | ZVSKZLHKADLHSD-UHFFFAOYSA-N |
| Molecular Formula | C13H11NO |
Methyl 3-(methylthio)propionate, 98%
CAS: 13532-18-8 Molecular Formula: C5H10O2S Molecular Weight (g/mol): 134.19 MDL Number: MFCD00008565 InChI Key: DMMJVMYCBULSIS-UHFFFAOYSA-N Synonym: methyl 3-methylthio propionate,methyl 3-methylthiopropionate,methyl 3-methylthio propanoate,propanoic acid, 3-methylthio-, methyl ester,methyl beta-methiopropionate,methyl 3-methylsulfanyl propanoate,methyl-3-methylthio propionate,methyl 3-methylthiopropanoate,propionic acid, 3-methylthio-, methyl ester,methyl beta-methylthiopropionate PubChem CID: 61641 IUPAC Name: methyl 3-methylsulfanylpropanoate SMILES: COC(=O)CCSC
| PubChem CID | 61641 |
|---|---|
| CAS | 13532-18-8 |
| Molecular Weight (g/mol) | 134.19 |
| MDL Number | MFCD00008565 |
| SMILES | COC(=O)CCSC |
| Synonym | methyl 3-methylthio propionate,methyl 3-methylthiopropionate,methyl 3-methylthio propanoate,propanoic acid, 3-methylthio-, methyl ester,methyl beta-methiopropionate,methyl 3-methylsulfanyl propanoate,methyl-3-methylthio propionate,methyl 3-methylthiopropanoate,propionic acid, 3-methylthio-, methyl ester,methyl beta-methylthiopropionate |
| IUPAC Name | methyl 3-methylsulfanylpropanoate |
| InChI Key | DMMJVMYCBULSIS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2S |
Methyl 4-aminobenzoate, 98%
CAS: 619-45-4 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.165 MDL Number: MFCD00007891 InChI Key: LZXXNPOYQCLXRS-UHFFFAOYSA-N Synonym: 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester PubChem CID: 12082 IUPAC Name: methyl 4-aminobenzoate SMILES: COC(=O)C1=CC=C(C=C1)N
| PubChem CID | 12082 |
|---|---|
| CAS | 619-45-4 |
| Molecular Weight (g/mol) | 151.165 |
| MDL Number | MFCD00007891 |
| SMILES | COC(=O)C1=CC=C(C=C1)N |
| Synonym | 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester |
| IUPAC Name | methyl 4-aminobenzoate |
| InChI Key | LZXXNPOYQCLXRS-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
Sodium oxalate, 99%
CAS: 62-76-0 Molecular Formula: C2Na2O4 Molecular Weight (g/mol): 134.00 MDL Number: MFCD00012465 InChI Key: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC Name: disodium;oxalate SMILES: [Na+].[Na+].[O-]C(=O)C([O-])=O
| PubChem CID | 6125 |
|---|---|
| CAS | 62-76-0 |
| Molecular Weight (g/mol) | 134.00 |
| MDL Number | MFCD00012465 |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| IUPAC Name | disodium;oxalate |
| InChI Key | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molecular Formula | C2Na2O4 |
Methyl bromoacetate, 98+%
CAS: 96-32-2 Molecular Formula: C3H5BrO2 Molecular Weight (g/mol): 152.975 MDL Number: MFCD00000189 InChI Key: YDCHPLOFQATIDS-UHFFFAOYSA-N Synonym: methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech PubChem CID: 60984 IUPAC Name: methyl 2-bromoacetate SMILES: COC(=O)CBr
| PubChem CID | 60984 |
|---|---|
| CAS | 96-32-2 |
| Molecular Weight (g/mol) | 152.975 |
| MDL Number | MFCD00000189 |
| SMILES | COC(=O)CBr |
| Synonym | methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech |
| IUPAC Name | methyl 2-bromoacetate |
| InChI Key | YDCHPLOFQATIDS-UHFFFAOYSA-N |
| Molecular Formula | C3H5BrO2 |
Ethyl isovalerate, 98%
CAS: 108-64-5 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.187 MDL Number: MFCD00009203 InChI Key: PPXUHEORWJQRHJ-UHFFFAOYSA-N Synonym: ethyl isovalerate,ethyl 3-methylbutyrate,ethylisovalerate,ethyl isopentanoate,isovaleric acid, ethyl ester,butanoic acid, 3-methyl-, ethyl ester,ethyl beta-methylbutyrate,ethyl isovalerianate,3-methylbutyric acid ethyl ester,3-methylbutanoic acid ethyl ester PubChem CID: 7945 ChEBI: CHEBI:31571 IUPAC Name: ethyl 3-methylbutanoate SMILES: CCOC(=O)CC(C)C
| PubChem CID | 7945 |
|---|---|
| CAS | 108-64-5 |
| Molecular Weight (g/mol) | 130.187 |
| ChEBI | CHEBI:31571 |
| MDL Number | MFCD00009203 |
| SMILES | CCOC(=O)CC(C)C |
| Synonym | ethyl isovalerate,ethyl 3-methylbutyrate,ethylisovalerate,ethyl isopentanoate,isovaleric acid, ethyl ester,butanoic acid, 3-methyl-, ethyl ester,ethyl beta-methylbutyrate,ethyl isovalerianate,3-methylbutyric acid ethyl ester,3-methylbutanoic acid ethyl ester |
| IUPAC Name | ethyl 3-methylbutanoate |
| InChI Key | PPXUHEORWJQRHJ-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Oxamide, 98+%
CAS: 471-46-5 Molecular Formula: C2H4N2O2 Molecular Weight (g/mol): 88.066 MDL Number: MFCD00008007 InChI Key: YIKSCQDJHCMVMK-UHFFFAOYSA-N Synonym: ethanediamide,oxalamide,oxamimidic acid,oxalic acid diamide,diaminoglyoxal,oxamid,amid kyseliny stavelove,formimidic acid, 1-carbamoyl,oxamid czech,unii-sbe4m0223e PubChem CID: 10113 ChEBI: CHEBI:48248 IUPAC Name: oxamide SMILES: C(=O)(C(=O)N)N
| PubChem CID | 10113 |
|---|---|
| CAS | 471-46-5 |
| Molecular Weight (g/mol) | 88.066 |
| ChEBI | CHEBI:48248 |
| MDL Number | MFCD00008007 |
| SMILES | C(=O)(C(=O)N)N |
| Synonym | ethanediamide,oxalamide,oxamimidic acid,oxalic acid diamide,diaminoglyoxal,oxamid,amid kyseliny stavelove,formimidic acid, 1-carbamoyl,oxamid czech,unii-sbe4m0223e |
| IUPAC Name | oxamide |
| InChI Key | YIKSCQDJHCMVMK-UHFFFAOYSA-N |
| Molecular Formula | C2H4N2O2 |
1-Naphthylacetic acid, 95%, may cont. up to 5% 2-isomer
CAS: 86-87-3 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00004046 InChI Key: PRPINYUDVPFIRX-UHFFFAOYSA-N Synonym: 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop PubChem CID: 6862 ChEBI: CHEBI:32918 IUPAC Name: 2-naphthalen-1-ylacetic acid SMILES: OC(=O)CC1=C2C=CC=CC2=CC=C1
| PubChem CID | 6862 |
|---|---|
| CAS | 86-87-3 |
| Molecular Weight (g/mol) | 186.21 |
| ChEBI | CHEBI:32918 |
| MDL Number | MFCD00004046 |
| SMILES | OC(=O)CC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop |
| IUPAC Name | 2-naphthalen-1-ylacetic acid |
| InChI Key | PRPINYUDVPFIRX-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
Ethyl decanoate, 99%
CAS: 110-38-3 Molecular Formula: C12H24O2 Molecular Weight (g/mol): 200.322 MDL Number: MFCD00009581 InChI Key: RGXWDWUGBIJHDO-UHFFFAOYSA-N Synonym: ethyl caprate,ethyl caprinate,ethyl decylate,decanoic acid ethyl ester,decanoic acid, ethyl ester,capric acid ethyl ester,ethyl n-decanoate,capric acid, ethyl ester,natural,unii-gy39fb86uo PubChem CID: 8048 ChEBI: CHEBI:87430 IUPAC Name: ethyl decanoate SMILES: CCCCCCCCCC(=O)OCC
| PubChem CID | 8048 |
|---|---|
| CAS | 110-38-3 |
| Molecular Weight (g/mol) | 200.322 |
| ChEBI | CHEBI:87430 |
| MDL Number | MFCD00009581 |
| SMILES | CCCCCCCCCC(=O)OCC |
| Synonym | ethyl caprate,ethyl caprinate,ethyl decylate,decanoic acid ethyl ester,decanoic acid, ethyl ester,capric acid ethyl ester,ethyl n-decanoate,capric acid, ethyl ester,natural,unii-gy39fb86uo |
| IUPAC Name | ethyl decanoate |
| InChI Key | RGXWDWUGBIJHDO-UHFFFAOYSA-N |
| Molecular Formula | C12H24O2 |
2-Ethylhexyl methacrylate, 98%, stab. with 4-methoxyphenol
CAS: 688-84-6 Molecular Formula: C12H22O2 Molecular Weight (g/mol): 198.306 MDL Number: MFCD00009494 InChI Key: WDQMWEYDKDCEHT-UHFFFAOYSA-N Synonym: 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 PubChem CID: 12713 IUPAC Name: 2-ethylhexyl 2-methylprop-2-enoate SMILES: CCCCC(CC)COC(=O)C(=C)C
| PubChem CID | 12713 |
|---|---|
| CAS | 688-84-6 |
| Molecular Weight (g/mol) | 198.306 |
| MDL Number | MFCD00009494 |
| SMILES | CCCCC(CC)COC(=O)C(=C)C |
| Synonym | 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 |
| IUPAC Name | 2-ethylhexyl 2-methylprop-2-enoate |
| InChI Key | WDQMWEYDKDCEHT-UHFFFAOYSA-N |
| Molecular Formula | C12H22O2 |